Products 1216443-97-8

CAS 1216443-97-8 is the registry number for (2,2-Dimethyl-3-oxo-1-piperazinyl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(2,2-dimethyl-3-oxopiperazin-1-yl)acetic acid;hydrochloride (CAS 1216443-97-8) is a chemical compound with the molecular formula C8H15ClN2O3 and a molecular weight of 222.67 g/mol. IUPAC name: 2-(2,2-dimethyl-3-oxopiperazin-1-yl)acetic acid;hydrochloride. InChIKey: ASAFONVRXQQNOH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15ClN2O3
Molecular weight222.67 g/mol
IUPAC name2-(2,2-dimethyl-3-oxopiperazin-1-yl)acetic acid;hydrochloride
InChIKeyASAFONVRXQQNOH-UHFFFAOYSA-N
SMILESCC1(C(=O)NCCN1CC(=O)O)C.Cl

Computed by PubChem (NCBI)