Products 2137482-10-9
CAS 2137482-10-9 is the registry number for 2-(3-Amino-2-oxoazepan-1-yl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3-amino-2-oxoazepan-1-yl)acetic acid;hydrochloride (CAS 2137482-10-9) is a chemical compound with the molecular formula C8H15ClN2O3 and a molecular weight of 222.67 g/mol. IUPAC name: 2-(3-amino-2-oxoazepan-1-yl)acetic acid;hydrochloride. InChIKey: UFBHLOVKIMGYJX-UHFFFAOYSA-N.
| Molecular formula | C8H15ClN2O3 |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 2-(3-amino-2-oxoazepan-1-yl)acetic acid;hydrochloride |
| InChIKey | UFBHLOVKIMGYJX-UHFFFAOYSA-N |
| SMILES | C1CCN(C(=O)C(C1)N)CC(=O)O.Cl |
Computed by PubChem (NCBI)