CAS 1216457-76-9 appears in our catalog under these names: 3,4,4'-Trichlorocarbanilide-13C6 (Triclocarban-13C6), >95% (HPLC), Triclocarban-13C6, 99.23%. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
1-(4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-3-(3,4-dichlorophenyl)urea (CAS 1216457-76-9) is a chemical compound with the molecular formula C13H9Cl3N2O and a molecular weight of 321.5 g/mol. IUPAC name: 1-(4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-3-(3,4-dichlorophenyl)urea. InChIKey: ICUTUKXCWQYESQ-MROVPUMUSA-N.
| Molecular formula | C13H9Cl3N2O |
|---|---|
| Molecular weight | 321.5 g/mol |
| IUPAC name | 1-(4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-3-(3,4-dichlorophenyl)urea |
| InChIKey | ICUTUKXCWQYESQ-MROVPUMUSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)N[13C]2=[13CH][13CH]=[13C]([13CH]=[13CH]2)Cl)Cl)Cl |
Computed by PubChem (NCBI)