Products 1216461-57-2
CAS 1216461-57-2 appears in our catalog under these names: Cletoquine-d4 Oxalate, >95% (HPLC), Cletoquine-d4 Oxalate. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
2-[[4-[(7-chloroquinolin-4-yl)amino]-1,1,2,2-tetradeuteriopentyl]amino]ethanol;oxalic acid (CAS 1216461-57-2) is a chemical compound with the molecular formula C18H24ClN3O5 and a molecular weight of 401.9 g/mol. IUPAC name: 2-[[4-[(7-chloroquinolin-4-yl)amino]-1,1,2,2-tetradeuteriopentyl]amino]ethanol;oxalic acid. InChIKey: DTVGVTDECKJJJK-XNXUTHBPSA-N.
| Molecular formula | C18H24ClN3O5 |
|---|---|
| Molecular weight | 401.9 g/mol |
| IUPAC name | 2-[[4-[(7-chloroquinolin-4-yl)amino]-1,1,2,2-tetradeuteriopentyl]amino]ethanol;oxalic acid |
| InChIKey | DTVGVTDECKJJJK-XNXUTHBPSA-N |
| SMILES | [2H]C([2H])(CC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)C([2H])([2H])NCCO.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)