Products 14142-64-4
CAS 14142-64-4 appears in our catalog under these names: Cletoquine Oxalate, >95% (HPLC), Cletoquine oxalate, 98%, Cletoquine oxalate, Cletoquine oxalate, Cletoquine (oxalate), 99.76%, 99.76%. Offered by: TRC, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 1mg, 5mg, 100mg, 25mg, 50mg, 10mg, 10mM/1mL, 50 mg.
2-[4-[(7-chloroquinolin-4-yl)amino]pentylamino]ethanol;oxalic acid (CAS 14142-64-4) is a chemical compound with the molecular formula C18H24ClN3O5 and a molecular weight of 397.9 g/mol. IUPAC name: 2-[4-[(7-chloroquinolin-4-yl)amino]pentylamino]ethanol;oxalic acid. InChIKey: DTVGVTDECKJJJK-UHFFFAOYSA-N.
| Molecular formula | C18H24ClN3O5 |
|---|---|
| Molecular weight | 397.9 g/mol |
| IUPAC name | 2-[4-[(7-chloroquinolin-4-yl)amino]pentylamino]ethanol;oxalic acid |
| InChIKey | DTVGVTDECKJJJK-UHFFFAOYSA-N |
| SMILES | CC(CCCNCCO)NC1=C2C=CC(=CC2=NC=C1)Cl.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Cletoquine Oxalate, Cletoquine (oxalate), 2-[4-[(7-chloroquinolin-4-yl)amino]pentylamino]ethanol;oxalic acid, Desethylhydroxychloroquine (oxalate), starbld0000859, C18H24ClN3O5, orb1710031, Hydroxychloroquine EP Impurity C Oxalate, 2-[4-[(7-chloro-4-quinolyl)amino]pentylamino]ethanol;oxalic acid, Oxalic acid--2-({4-[(7-chloroquinolin-4-yl)amino]pentyl}amino)ethan-1-ol (1/1)