CAS 1216494-11-9 appears in our catalog under these names: (R)-Rabeprazole-d3 Sodium Salt, >95% (HPLC), (S)-Rabeprazole-d3 Sodium Salt, >95% (HPLC), Rabeprazole-d3 (sodium). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
Sodium 2-[[3-methyl-4-[3-(trideuteriomethoxy)propoxy]-2-pyridinyl]methylsulfinyl]benzimidazol-1-ide (CAS 1216494-11-9) is a chemical compound with the molecular formula C18H20N3NaO3S and a molecular weight of 384.4 g/mol. IUPAC name: sodium 2-[[3-methyl-4-[3-(trideuteriomethoxy)propoxy]-2-pyridinyl]methylsulfinyl]benzimidazol-1-ide. InChIKey: KRCQSTCYZUOBHN-MUTAZJQDSA-N.
| Molecular formula | C18H20N3NaO3S |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | sodium 2-[[3-methyl-4-[3-(trideuteriomethoxy)propoxy]-2-pyridinyl]methylsulfinyl]benzimidazol-1-ide |
| InChIKey | KRCQSTCYZUOBHN-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])OCCCOC1=C(C(=NC=C1)CS(=O)C2=NC3=CC=CC=C3[N-]2)C.[Na+] |
Computed by PubChem (NCBI)