CAS 171440-18-9 appears in our catalog under these names: (R)-Rabeprazole Sodium Salt, (R)-Rabeprazole Sodium Salt, >95% (HPLC), (R)–(+)–Rabeprazole sodium, (R)-Rabeprazole sodium, Dexrabeprazole sodium 95%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 100mg, 10mg, 25mg, 1g, 250mg, 5g, 50mg.
Sodium 2-[(R)-[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]benzimidazol-1-ide (CAS 171440-18-9) is a chemical compound with the molecular formula C18H20N3NaO3S and a molecular weight of 381.4 g/mol. IUPAC name: sodium 2-[(R)-[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]benzimidazol-1-ide. InChIKey: KRCQSTCYZUOBHN-VQIWEWKSSA-N.
| Molecular formula | C18H20N3NaO3S |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | sodium 2-[(R)-[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]benzimidazol-1-ide |
| InChIKey | KRCQSTCYZUOBHN-VQIWEWKSSA-N |
| SMILES | CC1=C(C=CN=C1C[S@@](=O)C2=NC3=CC=CC=C3[N-]2)OCCCOC.[Na+] |
Computed by PubChem (NCBI)