Products 1216523-27-1
CAS 1216523-27-1 is the registry number for 4-Hydroxy-N-isopropyl-N-methyltryptamine-d4. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
3-[1,1,2,2-tetradeuterio-2-[methyl(propan-2-yl)amino]ethyl]-1H-indol-4-ol (CAS 1216523-27-1) is a chemical compound with the molecular formula C14H20N2O and a molecular weight of 236.35 g/mol. IUPAC name: 3-[1,1,2,2-tetradeuterio-2-[methyl(propan-2-yl)amino]ethyl]-1H-indol-4-ol. InChIKey: RXKGHZCQFXXWFQ-OSEHSPPNSA-N.
| Molecular formula | C14H20N2O |
|---|---|
| Molecular weight | 236.35 g/mol |
| IUPAC name | 3-[1,1,2,2-tetradeuterio-2-[methyl(propan-2-yl)amino]ethyl]-1H-indol-4-ol |
| InChIKey | RXKGHZCQFXXWFQ-OSEHSPPNSA-N |
| SMILES | [2H]C([2H])(C1=CNC2=C1C(=CC=C2)O)C([2H])([2H])N(C)C(C)C |
Computed by PubChem (NCBI)