CAS 1216572-34-7 is the registry number for 2,4,5-Trichlorophenoxyacetic Acid-13C6. Offered by: TRC. Available pack sizes: 10mg.
2-(3,4,6-trichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyacetic acid (CAS 1216572-34-7) is a chemical compound with the molecular formula C8H5Cl3O3 and a molecular weight of 261.43 g/mol. IUPAC name: 2-(3,4,6-trichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyacetic acid. InChIKey: SMYMJHWAQXWPDB-ZRDHQLPYSA-N.
| Molecular formula | C8H5Cl3O3 |
|---|---|
| Molecular weight | 261.43 g/mol |
| IUPAC name | 2-(3,4,6-trichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyacetic acid |
| InChIKey | SMYMJHWAQXWPDB-ZRDHQLPYSA-N |
| SMILES | [13CH]1=[13C]([13C](=[13CH][13C](=[13C]1Cl)Cl)Cl)OCC(=O)O |
Computed by PubChem (NCBI)