Products 358731-37-0
CAS 358731-37-0 appears in our catalog under these names: (2,4,5-Trichlorophenoxy-3,6-d2)acetic-d2 Acid, 99 atom % D, min 98% Chemical Purity, 2,4,5-T D4 100 µg/mL in Acetone, 2,4,5-Trichlorophenoxyacetic Acid-d4, >95% (HPLC), D4-2,4,5-T, Concentration: 100 µg/ml Solvent: Acetone. Offered by: CDN, Dr. Ehrenstorfer, TRC, HPC Standards. Available pack sizes: 0,05g, 0,01g, 1ml, 2,5mg, 25mg, 1x1ml.
2,2-dideuterio-2-(2,4,5-trichloro-3,6-dideuteriophenoxy)acetic acid (CAS 358731-37-0) is a chemical compound with the molecular formula C8H5Cl3O3 and a molecular weight of 259.5 g/mol. IUPAC name: 2,2-dideuterio-2-(2,4,5-trichloro-3,6-dideuteriophenoxy)acetic acid. InChIKey: SMYMJHWAQXWPDB-QZDQLYPWSA-N.
| Molecular formula | C8H5Cl3O3 |
|---|---|
| Molecular weight | 259.5 g/mol |
| IUPAC name | 2,2-dideuterio-2-(2,4,5-trichloro-3,6-dideuteriophenoxy)acetic acid |
| InChIKey | SMYMJHWAQXWPDB-QZDQLYPWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Cl)Cl)[2H])Cl)OC([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2,4,5-Trichlorophenoxyacetic acid-d4, 2,2-dideuterio-2-(2,4,5-trichloro-3,6-dideuteriophenoxy)acetic acid, 2,4,5-Trichlorophenoxyacetic Acid-d5, (2,4,5-Trichlorophenoxy-3,6-d2)acetic-d2 Acid, orb2299588, 2,4,5-T D4 100 |Ig/mL in Acetone, 2,4,5-T D4 100 microg/mL in Acetone, 2-[2,4,5-trichloro(3,6-?H?)phenoxy](?H?)acetic acid