Products 1216629-00-3
CAS 1216629-00-3 appears in our catalog under these names: 3-Methyl-GABA, 99.86%, 3-Methyl-GABA, 98.0%, 98.0%. Offered by: MedChemExpress, Chemat. Available pack sizes: 5 mg, 10 mg, 25 mg, 50 mg, 5mg.
Bis(4-amino-3-methylbutanoic acid);naphthalene-1,5-disulfonic acid (CAS 1216629-00-3) is a chemical compound with the molecular formula C20H30N2O10S2 and a molecular weight of 522.6 g/mol. IUPAC name: bis(4-amino-3-methylbutanoic acid);naphthalene-1,5-disulfonic acid. InChIKey: XDPUYXWLPXNCDY-UHFFFAOYSA-N.
| Molecular formula | C20H30N2O10S2 |
|---|---|
| Molecular weight | 522.6 g/mol |
| IUPAC name | bis(4-amino-3-methylbutanoic acid);naphthalene-1,5-disulfonic acid |
| InChIKey | XDPUYXWLPXNCDY-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)O)CN.CC(CC(=O)O)CN.C1=CC2=C(C=CC=C2S(=O)(=O)O)C(=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Methyl-GABA, 4-Amino-3-methylbutyric Acid Heminaphthalene-1,5-disulfonate, orb1704739, 4-amino-3-methylbutanoic acid;naphthalene-1,5-disulfonic acid, 4-Amino-3-methylbutanoic acid heminaphthalene-1,5-disulfonic acid salt, 4-Amino-3-methylbutanoic acid--naphthalene-1,5-disulfonic acid (2/1)