Products 1216673-02-7
CAS 1216673-02-7 appears in our catalog under these names: (±)-Linalool-d3 (vinyl-d3), (±)-Linalool-d3 (vinyl-d3), 99 atom % D, min 96% Chemical Purity, (±)–Linalool–d3, Linalool-d3, 95.17%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 0,05g, 0,01g, 10mg, 5 mg, 10 mg.
1,1,2-trideuterio-3,7-dimethylocta-1,6-dien-3-ol (CAS 1216673-02-7) is a chemical compound with the molecular formula C10H18O and a molecular weight of 157.27 g/mol. IUPAC name: 1,1,2-trideuterio-3,7-dimethylocta-1,6-dien-3-ol. InChIKey: CDOSHBSSFJOMGT-WSWICNJZSA-N.
| Molecular formula | C10H18O |
|---|---|
| Molecular weight | 157.27 g/mol |
| IUPAC name | 1,1,2-trideuterio-3,7-dimethylocta-1,6-dien-3-ol |
| InChIKey | CDOSHBSSFJOMGT-WSWICNJZSA-N |
| SMILES | [2H]C(=C([2H])C(C)(CCC=C(C)C)O)[2H] |
Computed by PubChem (NCBI)