Products 159592-39-9
CAS 159592-39-9 appears in our catalog under these names: Linalool-D5, Linalool-d5, 99.0%, D5-Linalool, D5-Linalool, Concentration: 100 µg/ml Solvent: Methanol. Offered by: TRC, MedChemExpress, HPC Standards. Available pack sizes: 25mg, 5 mg, 1 mg, 1x10mg, 1x1ml.
4,4-dideuterio-7-methyl-3-(trideuteriomethyl)octa-1,6-dien-3-ol (CAS 159592-39-9) is a chemical compound with the molecular formula C10H18O and a molecular weight of 159.28 g/mol. IUPAC name: 4,4-dideuterio-7-methyl-3-(trideuteriomethyl)octa-1,6-dien-3-ol. InChIKey: CDOSHBSSFJOMGT-JVWKMBIZSA-N.
| Molecular formula | C10H18O |
|---|---|
| Molecular weight | 159.28 g/mol |
| IUPAC name | 4,4-dideuterio-7-methyl-3-(trideuteriomethyl)octa-1,6-dien-3-ol |
| InChIKey | CDOSHBSSFJOMGT-JVWKMBIZSA-N |
| SMILES | [2H]C([2H])([2H])C(C=C)(C([2H])([2H])CC=C(C)C)O |
Computed by PubChem (NCBI)
Synonyms:
linalool-d5, d5-Linalool