Products 1216719-27-5
CAS 1216719-27-5 is the registry number for 2–Benzylamino–2–methyl–1–propanol–d6. Offered by: GLPBio. Available pack sizes: 100mg.
2-(benzylamino)-3,3,3-trideuterio-2-(trideuteriomethyl)propan-1-ol (CAS 1216719-27-5) is a chemical compound with the molecular formula C11H17NO and a molecular weight of 185.30 g/mol. IUPAC name: 2-(benzylamino)-3,3,3-trideuterio-2-(trideuteriomethyl)propan-1-ol. InChIKey: JIDHEIXSIHNMCG-WFGJKAKNSA-N.
| Molecular formula | C11H17NO |
|---|---|
| Molecular weight | 185.30 g/mol |
| IUPAC name | 2-(benzylamino)-3,3,3-trideuterio-2-(trideuteriomethyl)propan-1-ol |
| InChIKey | JIDHEIXSIHNMCG-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(CO)(C([2H])([2H])[2H])NCC1=CC=CC=C1 |
Computed by PubChem (NCBI)