Products 1216722-76-7

CAS 1216722-76-7 is the registry number for N-Ethyl-3,4-(methylenedioxy)aniline-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 10 mg, 100 mg.

Structural formula: {0} (CAS {1})

N-(1,1,2,2,2-pentadeuterioethyl)-1,3-benzodioxol-5-amine (CAS 1216722-76-7) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 170.22 g/mol. IUPAC name: N-(1,1,2,2,2-pentadeuterioethyl)-1,3-benzodioxol-5-amine. InChIKey: FPKGTVXPIULTIP-ZBJDZAJPSA-N.

Identity
Molecular formulaC9H11NO2
Molecular weight170.22 g/mol
IUPAC nameN-(1,1,2,2,2-pentadeuterioethyl)-1,3-benzodioxol-5-amine
InChIKeyFPKGTVXPIULTIP-ZBJDZAJPSA-N
SMILES[2H]C([2H])([2H])C([2H])([2H])NC1=CC2=C(C=C1)OCO2

Computed by PubChem (NCBI)