CAS 1216739-35-3 appears in our catalog under these names: Bumetanide-d5, Bumetanide-d5, >95% (HPLC), Bumetanide-d5 (phenoxy-d5), 98 atom % D, min 98% Chemical Purity, Bumetanide–d5, Bumetanide-d5, 99.82%. Offered by: Chemat Brand, Hubei YoungXin, TRC, CDN, TargetMol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2,5mg.
3-(butylamino)-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoic acid (CAS 1216739-35-3) is a chemical compound with the molecular formula C17H20N2O5S and a molecular weight of 369.4 g/mol. IUPAC name: 3-(butylamino)-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoic acid. InChIKey: MAEIEVLCKWDQJH-UPKDRLQUSA-N.
| Molecular formula | C17H20N2O5S |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 3-(butylamino)-4-(2,3,4,5,6-pentadeuteriophenoxy)-5-sulfamoylbenzoic acid |
| InChIKey | MAEIEVLCKWDQJH-UPKDRLQUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])OC2=C(C=C(C=C2S(=O)(=O)N)C(=O)O)NCCCC)[2H])[2H] |
Computed by PubChem (NCBI)