CAS 704888-90-4 appears in our catalog under these names: ARP 100, ARP-100/ 98.24% (existing batch purity), ARP 100, ARP-100 96%, MMP-2 Inhibitor III 1PC X 5MG. Offered by: TRC, TargetMol, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 250mg, 5 mg.
N-hydroxy-2-[(4-phenylphenyl)sulfonyl-propan-2-yloxyamino]acetamide (CAS 704888-90-4) is a chemical compound with the molecular formula C17H20N2O5S and a molecular weight of 364.4 g/mol. IUPAC name: N-hydroxy-2-[(4-phenylphenyl)sulfonyl-propan-2-yloxyamino]acetamide. InChIKey: PHGLPDURIUEELR-UHFFFAOYSA-N.
| Molecular formula | C17H20N2O5S |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | N-hydroxy-2-[(4-phenylphenyl)sulfonyl-propan-2-yloxyamino]acetamide |
| InChIKey | PHGLPDURIUEELR-UHFFFAOYSA-N |
| SMILES | CC(C)ON(CC(=O)NO)S(=O)(=O)C1=CC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)