CAS 1216745-60-6 appears in our catalog under these names: rac Methotrimeprazine-d3 Hydrochloride, (Rac)-Levomepromazine-d3 (hydrochloride), 97.0%. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
N,N,2-trimethyl-3-[2-(trideuteriomethoxy)phenothiazin-10-yl]propan-1-amine;hydrochloride (CAS 1216745-60-6) is a chemical compound with the molecular formula C19H25ClN2OS and a molecular weight of 368.0 g/mol. IUPAC name: N,N,2-trimethyl-3-[2-(trideuteriomethoxy)phenothiazin-10-yl]propan-1-amine;hydrochloride. InChIKey: ODLGFPIWRAEFAN-NXIGQQGZSA-N.
| Molecular formula | C19H25ClN2OS |
|---|---|
| Molecular weight | 368.0 g/mol |
| IUPAC name | N,N,2-trimethyl-3-[2-(trideuteriomethoxy)phenothiazin-10-yl]propan-1-amine;hydrochloride |
| InChIKey | ODLGFPIWRAEFAN-NXIGQQGZSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC2=C(C=C1)SC3=CC=CC=C3N2CC(C)CN(C)C.Cl |
Computed by PubChem (NCBI)