CAS 2090-54-2 is the registry number for Aprobit. Offered by: TRC. Available pack sizes: 750mg.
2-hydroxyethyl-dimethyl-(1-phenothiazin-10-ylpropan-2-yl)azanium chloride (CAS 2090-54-2) is a chemical compound with the molecular formula C19H25ClN2OS and a molecular weight of 364.9 g/mol. IUPAC name: 2-hydroxyethyl-dimethyl-(1-phenothiazin-10-ylpropan-2-yl)azanium chloride. InChIKey: FUFHLEMGRBXVCF-UHFFFAOYSA-M.
| Molecular formula | C19H25ClN2OS |
|---|---|
| Molecular weight | 364.9 g/mol |
| IUPAC name | 2-hydroxyethyl-dimethyl-(1-phenothiazin-10-ylpropan-2-yl)azanium chloride |
| InChIKey | FUFHLEMGRBXVCF-UHFFFAOYSA-M |
| SMILES | CC(CN1C2=CC=CC=C2SC3=CC=CC=C31)[N+](C)(C)CCO.[Cl-] |
Computed by PubChem (NCBI)