CAS 1216833-74-7 appears in our catalog under these names: 7-Hydroxy amoxapine-d8, 7-Hydroxy Amoxapine-d8, >95% (HPLC). Offered by: MedChemExpress, TRC. Available pack sizes: 1 mg, 10 mg, 10mg, 1mg.
8-chloro-6-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)benzo[b][1,4]benzoxazepin-2-ol (CAS 1216833-74-7) is a chemical compound with the molecular formula C17H16ClN3O2 and a molecular weight of 337.8 g/mol. IUPAC name: 8-chloro-6-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)benzo[b][1,4]benzoxazepin-2-ol. InChIKey: MEUGUMOVYNSGEW-YEBVBAJPSA-N.
| Molecular formula | C17H16ClN3O2 |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | 8-chloro-6-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)benzo[b][1,4]benzoxazepin-2-ol |
| InChIKey | MEUGUMOVYNSGEW-YEBVBAJPSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C2=NC3=C(C=C(C=C3)O)OC4=C2C=C(C=C4)Cl)([2H])[2H])[2H] |
Computed by PubChem (NCBI)