Products 59009-93-7
CAS 59009-93-7 appears in our catalog under these names: Carburazepam (RGH 3331), Carburazepam. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, Get quote.
7-chloro-1-methyl-2-oxo-5-phenyl-3,5-dihydro-1,4-benzodiazepine-4-carboxamide (CAS 59009-93-7) is a chemical compound with the molecular formula C17H16ClN3O2 and a molecular weight of 329.8 g/mol. IUPAC name: 7-chloro-1-methyl-2-oxo-5-phenyl-3,5-dihydro-1,4-benzodiazepine-4-carboxamide. InChIKey: HFFJORVBQWPILU-UHFFFAOYSA-N.
| Molecular formula | C17H16ClN3O2 |
|---|---|
| Molecular weight | 329.8 g/mol |
| IUPAC name | 7-chloro-1-methyl-2-oxo-5-phenyl-3,5-dihydro-1,4-benzodiazepine-4-carboxamide |
| InChIKey | HFFJORVBQWPILU-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CN(C(C2=C1C=CC(=C2)Cl)C3=CC=CC=C3)C(=O)N |
Computed by PubChem (NCBI)