CAS 1216839-31-4 appears in our catalog under these names: Indole-2-carboxylic Acid-13C, >95% (HPLC), Indole-2-carboxylic acid-13C. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 5mg, 5 mg, 25 mg, 10 mg.
1H-indole-2-carboxylic acid (CAS 1216839-31-4) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 162.15 g/mol. IUPAC name: 1H-indole-2-carboxylic acid. InChIKey: HCUARRIEZVDMPT-QBZHADDCSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1H-indole-2-carboxylic acid |
| InChIKey | HCUARRIEZVDMPT-QBZHADDCSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)[13C](=O)O |
Computed by PubChem (NCBI)