CAS 1216901-55-1 is the registry number for 2–(4’–Acetoxy–2–fluoro–biphenyl–4–yl)propionic Acid–d3 Methyl Ester. Offered by: GLPBio. Available pack sizes: 50mg.
Methyl 2-[4-(4-acetyloxyphenyl)-3-fluorophenyl]-3,3,3-trideuteriopropanoate (CAS 1216901-55-1) is a chemical compound with the molecular formula C18H17FO4 and a molecular weight of 319.3 g/mol. IUPAC name: methyl 2-[4-(4-acetyloxyphenyl)-3-fluorophenyl]-3,3,3-trideuteriopropanoate. InChIKey: PPSZEZRRJWMPME-FIBGUPNXSA-N.
| Molecular formula | C18H17FO4 |
|---|---|
| Molecular weight | 319.3 g/mol |
| IUPAC name | methyl 2-[4-(4-acetyloxyphenyl)-3-fluorophenyl]-3,3,3-trideuteriopropanoate |
| InChIKey | PPSZEZRRJWMPME-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC(=C(C=C1)C2=CC=C(C=C2)OC(=O)C)F)C(=O)OC |
Computed by PubChem (NCBI)