CAS 478688-47-0 is the registry number for 1-(4-FLUOROPHENYL)-3-(3,4,5-TRIMETHOXYPHENYL)PROP-2-EN-1-ONE, (2E)-, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
(E)-1-(4-fluorophenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (CAS 478688-47-0) is a chemical compound with the molecular formula C18H17FO4 and a molecular weight of 316.3 g/mol. IUPAC name: (E)-1-(4-fluorophenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one. InChIKey: WXPAWDMWSJYTRJ-RUDMXATFSA-N.
| Molecular formula | C18H17FO4 |
|---|---|
| Molecular weight | 316.3 g/mol |
| IUPAC name | (E)-1-(4-fluorophenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| InChIKey | WXPAWDMWSJYTRJ-RUDMXATFSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)/C=C/C(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)