Products 1216956-86-3
CAS 1216956-86-3 is the registry number for Didesethyl Chloroquine Hydroxyacetamide-d4. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 10 mg, 1 mg.
N-[4-[(7-chloroquinolin-4-yl)amino]-1,1,2,2-tetradeuteriopentyl]-2-hydroxyacetamide (CAS 1216956-86-3) is a chemical compound with the molecular formula C16H20ClN3O2 and a molecular weight of 325.82 g/mol. IUPAC name: N-[4-[(7-chloroquinolin-4-yl)amino]-1,1,2,2-tetradeuteriopentyl]-2-hydroxyacetamide. InChIKey: MJFOIOWFYPCSSQ-BRVWLQDISA-N.
| Molecular formula | C16H20ClN3O2 |
|---|---|
| Molecular weight | 325.82 g/mol |
| IUPAC name | N-[4-[(7-chloroquinolin-4-yl)amino]-1,1,2,2-tetradeuteriopentyl]-2-hydroxyacetamide |
| InChIKey | MJFOIOWFYPCSSQ-BRVWLQDISA-N |
| SMILES | [2H]C([2H])(CC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)C([2H])([2H])NC(=O)CO |
Computed by PubChem (NCBI)