Products 199327-69-0

CAS 199327-69-0 is the registry number for Cediranib Impurity 1. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

4-chloro-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazoline (CAS 199327-69-0) is a chemical compound with the molecular formula C16H20ClN3O2 and a molecular weight of 321.80 g/mol. IUPAC name: 4-chloro-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazoline. InChIKey: DMBUDLCZXCWIMF-UHFFFAOYSA-N.

Identity
Molecular formulaC16H20ClN3O2
Molecular weight321.80 g/mol
IUPAC name4-chloro-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazoline
InChIKeyDMBUDLCZXCWIMF-UHFFFAOYSA-N
SMILESCOC1=C(C=C2C(=C1)C(=NC=N2)Cl)OCCCN3CCCC3

Computed by PubChem (NCBI)