CAS 1216995-54-8 is the registry number for Nor-Flunitrazepam-d3. Offered by: TRC. Available pack sizes: 10mg.
6,8,9-trideuterio-5-(2-fluorophenyl)-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 1216995-54-8) is a chemical compound with the molecular formula C15H10FN3O3 and a molecular weight of 302.27 g/mol. IUPAC name: 6,8,9-trideuterio-5-(2-fluorophenyl)-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: KNGIGRDYBQPXKQ-CRSPMMAGSA-N.
| Molecular formula | C15H10FN3O3 |
|---|---|
| Molecular weight | 302.27 g/mol |
| IUPAC name | 6,8,9-trideuterio-5-(2-fluorophenyl)-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | KNGIGRDYBQPXKQ-CRSPMMAGSA-N |
| SMILES | [2H]C1=C(C(=C(C2=C1NC(=O)CN=C2C3=CC=CC=C3F)[2H])[N+](=O)[O-])[2H] |
Computed by PubChem (NCBI)