CAS 2558-30-7 appears in our catalog under these names: Nor-Flunitrazepam, >95% (HPLC), Desmethylflunitrazepam, Desmethylflunitrazepam 0.1 mg/ml in Methanol, Desmethylflunitrazepam 1.0 mg/ml in Methanol, Desmethylflunitrazepam, 1mg/ml in Methanol. Offered by: TRC, Lipomed, LoGiCal, Mikromol, GLPBio. Available pack sizes: 100mg, 10mg, 50mg, 1ml, 1mg, 5mg, 25mg.
5-(2-fluorophenyl)-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 2558-30-7) is a chemical compound with the molecular formula C15H10FN3O3 and a molecular weight of 299.26 g/mol. IUPAC name: 5-(2-fluorophenyl)-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: KNGIGRDYBQPXKQ-UHFFFAOYSA-N.
| Molecular formula | C15H10FN3O3 |
|---|---|
| Molecular weight | 299.26 g/mol |
| IUPAC name | 5-(2-fluorophenyl)-7-nitro-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | KNGIGRDYBQPXKQ-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=C(C=C2)[N+](=O)[O-])C(=N1)C3=CC=CC=C3F |
Computed by PubChem (NCBI)