CAS 1217024-56-0 appears in our catalog under these names: Doxapram Impurity 2-13C4 (Morpholine-13C4), Morpholine-13C4. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 25mg, 5mg, 10mg, 50mg.
(2,3,5,6-13C4)1,4-oxazinane (CAS 1217024-56-0) is a chemical compound with the molecular formula C4H9NO and a molecular weight of 91.091 g/mol. IUPAC name: (2,3,5,6-13C4)1,4-oxazinane. InChIKey: YNAVUWVOSKDBBP-JCDJMFQYSA-N.
| Molecular formula | C4H9NO |
|---|---|
| Molecular weight | 91.091 g/mol |
| IUPAC name | (2,3,5,6-13C4)1,4-oxazinane |
| InChIKey | YNAVUWVOSKDBBP-JCDJMFQYSA-N |
| SMILES | [13CH2]1[13CH2]O[13CH2][13CH2]N1 |
Computed by PubChem (NCBI)