CAS 35530-94-0 is the registry number for 2,2,6,6-d4-Morpholine. Offered by: TRC. Available pack sizes: 250mg.
2,2,6,6-tetradeuteriomorpholine (CAS 35530-94-0) is a chemical compound with the molecular formula C4H9NO and a molecular weight of 91.14 g/mol. IUPAC name: 2,2,6,6-tetradeuteriomorpholine. InChIKey: YNAVUWVOSKDBBP-KHORGVISSA-N.
| Molecular formula | C4H9NO |
|---|---|
| Molecular weight | 91.14 g/mol |
| IUPAC name | 2,2,6,6-tetradeuteriomorpholine |
| InChIKey | YNAVUWVOSKDBBP-KHORGVISSA-N |
| SMILES | [2H]C1(CNCC(O1)([2H])[2H])[2H] |
Computed by PubChem (NCBI)