Products 1217055-71-4
CAS 1217055-71-4 appears in our catalog under these names: rac 2-Hydroxy Ibuprofen-d6, 2-Hydroxy Ibuprofen-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
2-[4-[3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propyl]phenyl]propanoic acid (CAS 1217055-71-4) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 228.32 g/mol. IUPAC name: 2-[4-[3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propyl]phenyl]propanoic acid. InChIKey: UJHKVYPPCJBOSG-XERRXZQWSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 228.32 g/mol |
| IUPAC name | 2-[4-[3,3,3-trideuterio-2-hydroxy-2-(trideuteriomethyl)propyl]phenyl]propanoic acid |
| InChIKey | UJHKVYPPCJBOSG-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])C(CC1=CC=C(C=C1)C(C)C(=O)O)(C([2H])([2H])[2H])O |
Computed by PubChem (NCBI)