Products 1217062-64-0
CAS 1217062-64-0 is the registry number for 7-Amino Flunitrazepam-13C,D3. Offered by: TRC. Available pack sizes: 25mg.
7-amino-5-(2-fluorophenyl)-1-(trideuterio(113C)methyl)-3H-1,4-benzodiazepin-2-one (CAS 1217062-64-0) is a chemical compound with the molecular formula C16H14FN3O and a molecular weight of 287.31 g/mol. IUPAC name: 7-amino-5-(2-fluorophenyl)-1-(trideuterio(113C)methyl)-3H-1,4-benzodiazepin-2-one. InChIKey: LTCDLGUFORGHGY-KQORAOOSSA-N.
| Molecular formula | C16H14FN3O |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | 7-amino-5-(2-fluorophenyl)-1-(trideuterio(113C)methyl)-3H-1,4-benzodiazepin-2-one |
| InChIKey | LTCDLGUFORGHGY-KQORAOOSSA-N |
| SMILES | [2H][13C]([2H])([2H])N1C(=O)CN=C(C2=C1C=CC(=C2)N)C3=CC=CC=C3F |
Computed by PubChem (NCBI)
Synonyms:
7-Amino Flunitrazepam-13C,d3