Products 219533-65-0
CAS 219533-65-0 appears in our catalog under these names: 7-Aminoflunitrazepam-D3, 7-Aminoflunitrazepam-D3, 0.1mg/ml in Acetonitrile, 7-Aminoflunitrazepam-D3, 1mg/ml in Acetonitrile. Offered by: Lipomed. Available pack sizes: 50mg, 100mg, 10mg, 1ml.
7-amino-5-(2-fluorophenyl)-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one (CAS 219533-65-0) is a chemical compound with the molecular formula C16H14FN3O and a molecular weight of 286.32 g/mol. IUPAC name: 7-amino-5-(2-fluorophenyl)-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one. InChIKey: LTCDLGUFORGHGY-FIBGUPNXSA-N.
| Molecular formula | C16H14FN3O |
|---|---|
| Molecular weight | 286.32 g/mol |
| IUPAC name | 7-amino-5-(2-fluorophenyl)-1-(trideuteriomethyl)-3H-1,4-benzodiazepin-2-one |
| InChIKey | LTCDLGUFORGHGY-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=O)CN=C(C2=C1C=CC(=C2)N)C3=CC=CC=C3F |
Computed by PubChem (NCBI)