CAS 1217079-88-3 appears in our catalog under these names: 3-{(4-(Trifluoromethyl)pyrimidin-2-yl)amino}benzoic acid, 3-((4-(Trifluoromethyl)pyrimidin-2-yl)amino)benzoic acid, 97%. Offered by: Biosynth, Ambeed. Available pack sizes: 0,5g, 5g, 250mg, 1g.
3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]benzoic acid (CAS 1217079-88-3) is a chemical compound with the molecular formula C12H8F3N3O2 and a molecular weight of 283.21 g/mol. IUPAC name: 3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]benzoic acid. InChIKey: BBTHODYMXCEZNZ-UHFFFAOYSA-N.
| Molecular formula | C12H8F3N3O2 |
|---|---|
| Molecular weight | 283.21 g/mol |
| IUPAC name | 3-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]benzoic acid |
| InChIKey | BBTHODYMXCEZNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC2=NC=CC(=N2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)