CAS 6605-17-0 is the registry number for Androgen receptor antagonist 12. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-nitro-N-[3-(trifluoromethyl)phenyl]pyridin-2-amine (CAS 6605-17-0) is a chemical compound with the molecular formula C12H8F3N3O2 and a molecular weight of 283.21 g/mol. IUPAC name: 5-nitro-N-[3-(trifluoromethyl)phenyl]pyridin-2-amine. InChIKey: QYJNHEVAXNCZEE-UHFFFAOYSA-N.
| Molecular formula | C12H8F3N3O2 |
|---|---|
| Molecular weight | 283.21 g/mol |
| IUPAC name | 5-nitro-N-[3-(trifluoromethyl)phenyl]pyridin-2-amine |
| InChIKey | QYJNHEVAXNCZEE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC2=NC=C(C=C2)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)