CAS 1217089-53-6 appears in our catalog under these names: Glycopyrrolate Impurity 17-d5, Phenylglyoxylic Acid-d5, >95% (HPLC), Phenylglyoxylic acid-d5. Offered by: Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 5 mg.
2-oxo-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid (CAS 1217089-53-6) is a chemical compound with the molecular formula C8H6O3 and a molecular weight of 155.16 g/mol. IUPAC name: 2-oxo-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid. InChIKey: FAQJJMHZNSSFSM-RALIUCGRSA-N.
| Molecular formula | C8H6O3 |
|---|---|
| Molecular weight | 155.16 g/mol |
| IUPAC name | 2-oxo-2-(2,3,4,5,6-pentadeuteriophenyl)acetic acid |
| InChIKey | FAQJJMHZNSSFSM-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)C(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)