CAS 19278-82-1 appears in our catalog under these names: 5-Hydroxy-3(2h)-benzofuranone, 95%, 5-Hydroxybenzofuran-3(2H)-one, 95+%, 5-Hydroxy-2,3-dihydro-1-benzofuran-3-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 50mg, 0,5g.
5-hydroxy-1-benzofuran-3-one (CAS 19278-82-1) is a chemical compound with the molecular formula C8H6O3 and a molecular weight of 150.13 g/mol. IUPAC name: 5-hydroxy-1-benzofuran-3-one. InChIKey: WCHUTMOUMWZQFD-UHFFFAOYSA-N.
| Molecular formula | C8H6O3 |
|---|---|
| Molecular weight | 150.13 g/mol |
| IUPAC name | 5-hydroxy-1-benzofuran-3-one |
| InChIKey | WCHUTMOUMWZQFD-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(O1)C=CC(=C2)O |
Computed by PubChem (NCBI)