Products 1217098-46-8

CAS 1217098-46-8 is the registry number for Glycinexylidide-d6. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 1 mg, 5 mg.

Structural formula: {0} (CAS {1})

2-amino-N-[2,6-bis(trideuteriomethyl)phenyl]acetamide (CAS 1217098-46-8) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 184.27 g/mol. IUPAC name: 2-amino-N-[2,6-bis(trideuteriomethyl)phenyl]acetamide. InChIKey: IXYVBZOSGGJWCW-WFGJKAKNSA-N.

Identity
Molecular formulaC10H14N2O
Molecular weight184.27 g/mol
IUPAC name2-amino-N-[2,6-bis(trideuteriomethyl)phenyl]acetamide
InChIKeyIXYVBZOSGGJWCW-WFGJKAKNSA-N
SMILES[2H]C([2H])([2H])C1=C(C(=CC=C1)C([2H])([2H])[2H])NC(=O)CN

Computed by PubChem (NCBI)