CAS 1217098-46-8 is the registry number for Glycinexylidide-d6. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 1 mg, 5 mg.
2-amino-N-[2,6-bis(trideuteriomethyl)phenyl]acetamide (CAS 1217098-46-8) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 184.27 g/mol. IUPAC name: 2-amino-N-[2,6-bis(trideuteriomethyl)phenyl]acetamide. InChIKey: IXYVBZOSGGJWCW-WFGJKAKNSA-N.
| Molecular formula | C10H14N2O |
|---|---|
| Molecular weight | 184.27 g/mol |
| IUPAC name | 2-amino-N-[2,6-bis(trideuteriomethyl)phenyl]acetamide |
| InChIKey | IXYVBZOSGGJWCW-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=CC=C1)C([2H])([2H])[2H])NC(=O)CN |
Computed by PubChem (NCBI)