CAS 1217303-38-2 appears in our catalog under these names: 3-Fluoro-5-(trifluoromethyl)benzene-1,2-diamine, 95%, 1,2-Diamino-3-fluoro-5-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
3-fluoro-5-(trifluoromethyl)benzene-1,2-diamine (CAS 1217303-38-2) is a chemical compound with the molecular formula C7H6F4N2 and a molecular weight of 194.13 g/mol. IUPAC name: 3-fluoro-5-(trifluoromethyl)benzene-1,2-diamine. InChIKey: XROMSPYRRCZQLO-UHFFFAOYSA-N.
| Molecular formula | C7H6F4N2 |
|---|---|
| Molecular weight | 194.13 g/mol |
| IUPAC name | 3-fluoro-5-(trifluoromethyl)benzene-1,2-diamine |
| InChIKey | XROMSPYRRCZQLO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)N)F)C(F)(F)F |
Computed by PubChem (NCBI)