CAS 1260892-22-5 appears in our catalog under these names: (3–Fluoro–5–(trifluoromethyl)pyridin–2–yl)methanamine, (3-Fluoro-5-(trifluoromethyl)pyridin-2-yl)methanamine 95%, (3-Fluoro-5-(trifluoromethyl)pyridin-2-yl)methanamine, 95%, 95%, (3-Fluoro-5-(trifluoromethyl)pyridin-2-yl)methanamine, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 50mg, 250mg, 1g.
[3-fluoro-5-(trifluoromethyl)-2-pyridinyl]methanamine (CAS 1260892-22-5) is a chemical compound with the molecular formula C7H6F4N2 and a molecular weight of 194.13 g/mol. IUPAC name: [3-fluoro-5-(trifluoromethyl)-2-pyridinyl]methanamine. InChIKey: ZBSVPYCSWCQJHF-UHFFFAOYSA-N.
| Molecular formula | C7H6F4N2 |
|---|---|
| Molecular weight | 194.13 g/mol |
| IUPAC name | [3-fluoro-5-(trifluoromethyl)-2-pyridinyl]methanamine |
| InChIKey | ZBSVPYCSWCQJHF-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1F)CN)C(F)(F)F |
Computed by PubChem (NCBI)