Products 1217443-99-6
CAS 1217443-99-6 is the registry number for (S)-SCH-23390 (hydrochloride), 99.18%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 25 mg, 50 mg, 5 mg, 10 mg.
(5S)-8-chloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol;hydrochloride (CAS 1217443-99-6) is a chemical compound with the molecular formula C17H19Cl2NO and a molecular weight of 324.2 g/mol. IUPAC name: (5S)-8-chloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol;hydrochloride. InChIKey: OYCAEWMSOPMASE-RSAXXLAASA-N.
| Molecular formula | C17H19Cl2NO |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | (5S)-8-chloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol;hydrochloride |
| InChIKey | OYCAEWMSOPMASE-RSAXXLAASA-N |
| SMILES | CN1CCC2=CC(=C(C=C2[C@@H](C1)C3=CC=CC=C3)O)Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
S(-)-SCH-23388 hydrochloride, solid