Products 125941-87-9
CAS 125941-87-9 appears in our catalog under these names: (R)-(+)-Sch 23390 Hydrochloride, SCH-23390 hydrochloride/ 99.07% (existing batch purity), SCH 23390 hydrochloride, SCH 23390 hydrochloride, R(+)-SCH-23390 HYDROCHLORIDE. Offered by: TRC, TargetMol, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 1g, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
(5R)-8-chloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol;hydrochloride (CAS 125941-87-9) is a chemical compound with the molecular formula C17H19Cl2NO and a molecular weight of 324.2 g/mol. IUPAC name: (5R)-8-chloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol;hydrochloride. InChIKey: OYCAEWMSOPMASE-XFULWGLBSA-N.
| Molecular formula | C17H19Cl2NO |
|---|---|
| Molecular weight | 324.2 g/mol |
| IUPAC name | (5R)-8-chloro-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol;hydrochloride |
| InChIKey | OYCAEWMSOPMASE-XFULWGLBSA-N |
| SMILES | CN1CCC2=CC(=C(C=C2[C@H](C1)C3=CC=CC=C3)O)Cl.Cl |
Computed by PubChem (NCBI)