CAS 1217447-05-6 is the registry number for (1R,2S,4R)-2-(Chloromethoxy)-1-isopropyl-4-methylcyclohexane, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2S,4R)-2-(chloromethoxy)-4-methyl-1-propan-2-ylcyclohexane (CAS 1217447-05-6) is a chemical compound with the molecular formula C11H21ClO and a molecular weight of 204.73 g/mol. IUPAC name: (1R,2S,4R)-2-(chloromethoxy)-4-methyl-1-propan-2-ylcyclohexane. InChIKey: XOPLTFUYFXWFGB-MXWKQRLJSA-N.
| Molecular formula | C11H21ClO |
|---|---|
| Molecular weight | 204.73 g/mol |
| IUPAC name | (1R,2S,4R)-2-(chloromethoxy)-4-methyl-1-propan-2-ylcyclohexane |
| InChIKey | XOPLTFUYFXWFGB-MXWKQRLJSA-N |
| SMILES | C[C@@H]1CC[C@@H]([C@H](C1)OCCl)C(C)C |
Computed by PubChem (NCBI)