CAS 26127-08-2 is the registry number for (+)-Chloromethyl isomenthyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(1S,2R,4R)-2-(chloromethoxy)-4-methyl-1-propan-2-ylcyclohexane (CAS 26127-08-2) is a chemical compound with the molecular formula C11H21ClO and a molecular weight of 204.73 g/mol. IUPAC name: (1S,2R,4R)-2-(chloromethoxy)-4-methyl-1-propan-2-ylcyclohexane. InChIKey: XOPLTFUYFXWFGB-OUAUKWLOSA-N.
| Molecular formula | C11H21ClO |
|---|---|
| Molecular weight | 204.73 g/mol |
| IUPAC name | (1S,2R,4R)-2-(chloromethoxy)-4-methyl-1-propan-2-ylcyclohexane |
| InChIKey | XOPLTFUYFXWFGB-OUAUKWLOSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OCCl)C(C)C |
Computed by PubChem (NCBI)