Products 1217449-23-4
CAS 1217449-23-4 is the registry number for Fmoc-Thr(tBu)-OH-15N, 99.6%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 5 mg, 100 mg, 10 mg.
(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-[(2-methylpropan-2-yl)oxy]butanoic acid (CAS 1217449-23-4) is a chemical compound with the molecular formula C23H27NO5 and a molecular weight of 398.5 g/mol. IUPAC name: (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-[(2-methylpropan-2-yl)oxy]butanoic acid. InChIKey: LZOLWEQBVPVDPR-JFUFHFQJSA-N.
| Molecular formula | C23H27NO5 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-3-[(2-methylpropan-2-yl)oxy]butanoic acid |
| InChIKey | LZOLWEQBVPVDPR-JFUFHFQJSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)[15NH]C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(C)(C)C |
Computed by PubChem (NCBI)