Products 1217461-93-2
CAS 1217461-93-2 is the registry number for (S)-1-[(4-Isopropylphenyl)carbamoyl]pyrrolidine-2-carboxylic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S)-1-[(4-propan-2-ylphenyl)carbamoyl]pyrrolidine-2-carboxylic acid (CAS 1217461-93-2) is a chemical compound with the molecular formula C15H20N2O3 and a molecular weight of 276.33 g/mol. IUPAC name: (2S)-1-[(4-propan-2-ylphenyl)carbamoyl]pyrrolidine-2-carboxylic acid. InChIKey: POJFATZZEBLSAU-ZDUSSCGKSA-N.
| Molecular formula | C15H20N2O3 |
|---|---|
| Molecular weight | 276.33 g/mol |
| IUPAC name | (2S)-1-[(4-propan-2-ylphenyl)carbamoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | POJFATZZEBLSAU-ZDUSSCGKSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)NC(=O)N2CCC[C@H]2C(=O)O |
Computed by PubChem (NCBI)