Products 1217463-58-5
CAS 1217463-58-5 is the registry number for D-Mannitol-13C,d2. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 1 mg.
(2R,3R,4R,5R)-1,1-dideuterio(113C)hexane-1,2,3,4,5,6-hexol (CAS 1217463-58-5) is a chemical compound with the molecular formula C6H14O6 and a molecular weight of 185.18 g/mol. IUPAC name: (2R,3R,4R,5R)-1,1-dideuterio(113C)hexane-1,2,3,4,5,6-hexol. InChIKey: FBPFZTCFMRRESA-ABCHWDNASA-N.
| Molecular formula | C6H14O6 |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | (2R,3R,4R,5R)-1,1-dideuterio(113C)hexane-1,2,3,4,5,6-hexol |
| InChIKey | FBPFZTCFMRRESA-ABCHWDNASA-N |
| SMILES | [2H][13C]([2H])([C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)O |
Computed by PubChem (NCBI)