Products 1217481-78-1
CAS 1217481-78-1 is the registry number for N3-Trp-OH·CHA. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 1g, 5g.
(2S)-2-azido-3-(1H-indol-3-yl)propanoic acid;cyclohexanamine (CAS 1217481-78-1) is a chemical compound with the molecular formula C17H23N5O2 and a molecular weight of 329.4 g/mol. IUPAC name: (2S)-2-azido-3-(1H-indol-3-yl)propanoic acid;cyclohexanamine. InChIKey: CONRNQTWYKMOCC-PPHPATTJSA-N.
| Molecular formula | C17H23N5O2 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | (2S)-2-azido-3-(1H-indol-3-yl)propanoic acid;cyclohexanamine |
| InChIKey | CONRNQTWYKMOCC-PPHPATTJSA-N |
| SMILES | C1CCC(CC1)N.C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)