CAS 2468771-13-1 is the registry number for Anastrozole Impurity 36. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-(1-amino-2-methyl-1-oxopropan-2-yl)-5-(1,2,4-triazol-4-ylmethyl)phenyl]-2-methylpropanamide (CAS 2468771-13-1) is a chemical compound with the molecular formula C17H23N5O2 and a molecular weight of 329.4 g/mol. IUPAC name: 2-[3-(1-amino-2-methyl-1-oxopropan-2-yl)-5-(1,2,4-triazol-4-ylmethyl)phenyl]-2-methylpropanamide. InChIKey: JWQJTBSCWRYJPY-UHFFFAOYSA-N.
| Molecular formula | C17H23N5O2 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 2-[3-(1-amino-2-methyl-1-oxopropan-2-yl)-5-(1,2,4-triazol-4-ylmethyl)phenyl]-2-methylpropanamide |
| InChIKey | JWQJTBSCWRYJPY-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC(=C1)CN2C=NN=C2)C(C)(C)C(=O)N)C(=O)N |
Computed by PubChem (NCBI)