Products 121749-65-3
CAS 121749-65-3 is the registry number for 3-(2,2,2-Trifluoro-1,1-dihydroxyethyl)oxolan-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(2,2,2-trifluoro-1,1-dihydroxyethyl)oxolan-2-one (CAS 121749-65-3) is a chemical compound with the molecular formula C6H7F3O4 and a molecular weight of 200.11 g/mol. IUPAC name: 3-(2,2,2-trifluoro-1,1-dihydroxyethyl)oxolan-2-one. InChIKey: UVUNIQLSVFYTIM-UHFFFAOYSA-N.
| Molecular formula | C6H7F3O4 |
|---|---|
| Molecular weight | 200.11 g/mol |
| IUPAC name | 3-(2,2,2-trifluoro-1,1-dihydroxyethyl)oxolan-2-one |
| InChIKey | UVUNIQLSVFYTIM-UHFFFAOYSA-N |
| SMILES | C1COC(=O)C1C(C(F)(F)F)(O)O |
Computed by PubChem (NCBI)